C17H29N6O3P — CID 162178184
N-[[(1R,7S,9S)-7-ethyl-9-methyl-8-oxa-2,3,4,5-tetrazatricyclo[5.2.1.02,6]deca-3,5-dien-10-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 162178184) has the molecular formula C17H29N6O3P and a molecular weight of 396.43 g/mol. Its IUPAC name is N-[[(1R,7S,9S)-7-ethyl-9-methyl-8-oxa-2,3,4,5-tetrazatricyclo[5.2.1.02,6]deca-3,5-dien-10-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[(1R,7S,9S)-7-ethyl-9-methyl-8-oxa-2,3,4,5-tetrazatricyclo[5.2.1.02,6]deca-3,5-dien-10-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 162178184 |
| Molecular Formula | C17H29N6O3P |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[[(1R,7S,9S)-7-ethyl-9-methyl-8-oxa-2,3,4,5-tetrazatricyclo[5.2.1.02,6]deca-3,5-dien-10-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | [C-]#[N+]CCOP(OC1[C@H]2[C@H](C)O[C@@]1(CC)c1nnnn12)N(C(C)C)C(C)C |
| InChI | InChI=1S/C17H29N6O3P/c1-8-17-15(14(13(6)25-17)22-16(17)19-20-21-22)26-27(24-10-9-18-7)23(11(2)3)12(4)5/h11-15H,8-10H2,1-6H3/t13-,14+,15?,17+,27?/m0/s1 |
| InChIKey | ZORABOXLTZKHTH-XNTBQZQWSA-N |
| XLogP | 2.92 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|