C16H20BrN5O2 — CID 162178686
N-(6-bromo-2-methyl-3-pyridinyl)-5-methoxy-6-piperidin-4-yloxypyrimidin-4-amine (PubChem CID 162178686) has the molecular formula C16H20BrN5O2 and a molecular weight of 394.27 g/mol. Its IUPAC name is N-(6-bromo-2-methyl-3-pyridinyl)-5-methoxy-6-piperidin-4-yloxypyrimidin-4-amine.
| Compound Name | N-(6-bromo-2-methyl-3-pyridinyl)-5-methoxy-6-piperidin-4-yloxypyrimidin-4-amine |
|---|---|
| PubChem CID | 162178686 |
| Molecular Formula | C16H20BrN5O2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(6-bromo-2-methyl-3-pyridinyl)-5-methoxy-6-piperidin-4-yloxypyrimidin-4-amine |
| SMILES | COc1c(Nc2ccc(Br)nc2C)ncnc1OC1CCNCC1 |
| InChI | InChI=1S/C16H20BrN5O2/c1-10-12(3-4-13(17)21-10)22-15-14(23-2)16(20-9-19-15)24-11-5-7-18-8-6-11/h3-4,9,11,18H,5-8H2,1-2H3,(H,19,20,22) |
| InChIKey | NXCLAZGLYHOIMP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|