C43H40Br2Cl2N3+ — CID 162181155
bis(4-bromophenyl)-[(2E)-2-[(2E)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-5-[2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]azanium (PubChem CID 162181155) has the molecular formula C43H40Br2Cl2N3+ and a molecular weight of 829.53 g/mol. Its IUPAC name is bis(4-bromophenyl)-[(2E)-2-[(2E)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-5-[2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]azanium.
| Compound Name | bis(4-bromophenyl)-[(2E)-2-[(2E)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-5-[2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]azanium |
|---|---|
| PubChem CID | 162181155 |
| Molecular Formula | C43H40Br2Cl2N3+ |
| Molecular Weight | 829.53 g/mol |
| Exact Mass | 826.10 |
| IUPAC Name | bis(4-bromophenyl)-[(2E)-2-[(2E)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-5-[2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]azanium |
| SMILES | CN1C(=CC=C2CC/C(=C\C=C3\N(C)c4ccc(Cl)cc4C3(C)C)C2=[N+](c2ccc(Br)cc2)c2ccc(Br)cc2)C(C)(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C43H40Br2Cl2N3/c1-42(2)35-25-31(46)15-21-37(35)48(5)39(42)23-9-27-7-8-28(10-24-40-43(3,4)36-26-32(47)16-22-38(36)49(40)6)41(27)50(33-17-11-29(44)12-18-33)34-19-13-30(45)14-20-34/h9-26H,7-8H2,1-6H3/q+1 |
| InChIKey | BVBITPHJKXLYJT-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.53 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|