C13H24N2O6 — CID 162181645
N-[[(6R)-5,6-dihydroxy-4-nitrooxan-2-yl]methyl]-4,4-dimethylpentanamide (PubChem CID 162181645) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is N-[[(6R)-5,6-dihydroxy-4-nitrooxan-2-yl]methyl]-4,4-dimethylpentanamide.
| Compound Name | N-[[(6R)-5,6-dihydroxy-4-nitrooxan-2-yl]methyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 162181645 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[[(6R)-5,6-dihydroxy-4-nitrooxan-2-yl]methyl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCC(=O)NCC1CC([N+](=O)[O-])C(O)[C@H](O)O1 |
| InChI | InChI=1S/C13H24N2O6/c1-13(2,3)5-4-10(16)14-7-8-6-9(15(19)20)11(17)12(18)21-8/h8-9,11-12,17-18H,4-7H2,1-3H3,(H,14,16)/t8?,9?,11?,12-/m1/s1 |
| InChIKey | ZPCJFUWXWCFQLP-HYHRHQCWSA-N |
| XLogP | 0.04 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|