C22H40O2 — CID 162181911
trans-(1R,2R)-1-methyl-2-pent-4-enylcyclopentan-1-ol;trans-(1S,2S)-1-methyl-2-pent-4-enylcyclopentan-1-ol (PubChem CID 162181911) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is trans-(1R,2R)-1-methyl-2-pent-4-enylcyclopentan-1-ol;trans-(1S,2S)-1-methyl-2-pent-4-enylcyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-1-methyl-2-pent-4-enylcyclopentan-1-ol;trans-(1S,2S)-1-methyl-2-pent-4-enylcyclopentan-1-ol |
|---|---|
| PubChem CID | 162181911 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | trans-(1R,2R)-1-methyl-2-pent-4-enylcyclopentan-1-ol;trans-(1S,2S)-1-methyl-2-pent-4-enylcyclopentan-1-ol |
| SMILES | C=CCCC[C@@H]1CCC[C@@]1(C)O.C=CCCC[C@H]1CCC[C@]1(C)O |
| InChI | InChI=1S/2C11H20O/c2*1-3-4-5-7-10-8-6-9-11(10,2)12/h2*3,10,12H,1,4-9H2,2H3/t2*10-,11-/m10/s1 |
| InChIKey | ZPDHJAAHBMTRLF-CDDKSXPSSA-N |
| XLogP | 5.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|