C23H23ClN2O5 — CID 162182087
ethyl 4-(2-chlorophenyl)-6-(3-methoxypropyl)-1,3-dioxopyrrolo[3,4-e]indole-7-carboxylate;molecular hydrogen (PubChem CID 162182087) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is ethyl 4-(2-chlorophenyl)-6-(3-methoxypropyl)-1,3-dioxopyrrolo[3,4-e]indole-7-carboxylate;molecular hydrogen.
| Compound Name | ethyl 4-(2-chlorophenyl)-6-(3-methoxypropyl)-1,3-dioxopyrrolo[3,4-e]indole-7-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 162182087 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | ethyl 4-(2-chlorophenyl)-6-(3-methoxypropyl)-1,3-dioxopyrrolo[3,4-e]indole-7-carboxylate;molecular hydrogen |
| SMILES | CCOC(=O)c1cc2c3c(c(-c4ccccc4Cl)cc2n1CCCOC)C(=O)NC3=O.[H][H] |
| InChI | InChI=1S/C23H21ClN2O5.H2/c1-3-31-23(29)18-12-15-17(26(18)9-6-10-30-2)11-14(13-7-4-5-8-16(13)24)19-20(15)22(28)25-21(19)27;/h4-5,7-8,11-12H,3,6,9-10H2,1-2H3,(H,25,27,28);1H |
| InChIKey | ZPDXHCKNHKVIKL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|