C42H39Cl3N8O4 — CID 162182812
ethyl 6-chloro-4-[4-(2-isocyanopropan-2-yl)anilino]-1,5-naphthyridine-3-carboxylate;ethyl 4,6-dichloro-1,5-naphthyridine-3-carboxylate;4-(2-isocyanopropan-2-yl)aniline (PubChem CID 162182812) has the molecular formula C42H39Cl3N8O4 and a molecular weight of 826.18 g/mol. Its IUPAC name is ethyl 6-chloro-4-[4-(2-isocyanopropan-2-yl)anilino]-1,5-naphthyridine-3-carboxylate;ethyl 4,6-dichloro-1,5-naphthyridine-3-carboxylate;4-(2-isocyanopropan-2-yl)aniline.
| Compound Name | ethyl 6-chloro-4-[4-(2-isocyanopropan-2-yl)anilino]-1,5-naphthyridine-3-carboxylate;ethyl 4,6-dichloro-1,5-naphthyridine-3-carboxylate;4-(2-isocyanopropan-2-yl)aniline |
|---|---|
| PubChem CID | 162182812 |
| Molecular Formula | C42H39Cl3N8O4 |
| Molecular Weight | 826.18 g/mol |
| Exact Mass | 824.22 |
| IUPAC Name | ethyl 6-chloro-4-[4-(2-isocyanopropan-2-yl)anilino]-1,5-naphthyridine-3-carboxylate;ethyl 4,6-dichloro-1,5-naphthyridine-3-carboxylate;4-(2-isocyanopropan-2-yl)aniline |
| SMILES | CCOC(=O)c1cnc2ccc(Cl)nc2c1Cl.[C-]#[N+]C(C)(C)c1ccc(N)cc1.[C-]#[N+]C(C)(C)c1ccc(Nc2c(C(=O)OCC)cnc3ccc(Cl)nc23)cc1 |
| InChI | InChI=1S/C21H19ClN4O2.C11H8Cl2N2O2.C10H12N2/c1-5-28-20(27)15-12-24-16-10-11-17(22)26-19(16)18(15)25-14-8-6-13(7-9-14)21(2,3)23-4;1-2-17-11(16)6-5-14-7-3-4-8(12)15-10(7)9(6)13;1-10(2,12-3)8-4-6-9(11)7-5-8/h6-12H,5H2,1-3H3,(H,24,25);3-5H,2H2,1H3;4-7H,11H2,1-2H3 |
| InChIKey | ZPGLZLJKFQVUBR-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 150.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.18 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|