About ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane
ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane (PubChem CID 162183952) has the molecular formula C19H32N2O2
and a molecular weight of 320.48 g/mol. Its IUPAC name is ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane |
| PubChem CID | 162183952 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2C3CCC(C3)C2C1.C=C(C)C(=O)NCC.CCOC#N |
| InChI | InChI=1S/C10H16.C6H11NO.C3H5NO/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-4-7-6(8)5(2)3;1-2-5-3-4/h7-10H,1-6H2;2,4H2,1,3H3,(H,7,8);2H2,1H3 |
| InChIKey | ZPKJCWYQTSSWJC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane?
The IUPAC name of ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane (CID 162183952) is ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane.
What is the SMILES notation for ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane?
The canonical SMILES for ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane is C1CC2C3CCC(C3)C2C1.C=C(C)C(=O)NCC.CCOC#N.
What is the InChIKey of ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane?
The InChIKey is ZPKJCWYQTSSWJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C6H11NO.C3H5NO/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-4-7-6(8)5(2)3;1-2-5-3-4/h7-10H,1-6H2;2,4H2,1,3H3,(H,7,8);2H2,1H3.
What are the key properties of ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane?
ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane has a molecular weight of 320.48 g/mol, XLogP of 4.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl cyanate;N-ethyl-2-methylprop-2-enamide;tricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 162183952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).