C12H15F3O2S — CID 162184314
4-(methylsulfonylmethyl)-1-propan-2-yl-2-(trifluoromethyl)benzene (PubChem CID 162184314) has the molecular formula C12H15F3O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-1-propan-2-yl-2-(trifluoromethyl)benzene.
| Compound Name | 4-(methylsulfonylmethyl)-1-propan-2-yl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 162184314 |
| Molecular Formula | C12H15F3O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-(methylsulfonylmethyl)-1-propan-2-yl-2-(trifluoromethyl)benzene |
| SMILES | CC(C)c1ccc(CS(C)(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3O2S/c1-8(2)10-5-4-9(7-18(3,16)17)6-11(10)12(13,14)15/h4-6,8H,7H2,1-3H3 |
| InChIKey | XNIWNXDOKDIMHV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |