C13H19ClO2S — CID 162184316
2-chloro-1-propan-2-yl-4-(propan-2-ylsulfonylmethyl)benzene (PubChem CID 162184316) has the molecular formula C13H19ClO2S and a molecular weight of 274.81 g/mol. Its IUPAC name is 2-chloro-1-propan-2-yl-4-(propan-2-ylsulfonylmethyl)benzene.
| Compound Name | 2-chloro-1-propan-2-yl-4-(propan-2-ylsulfonylmethyl)benzene |
|---|---|
| PubChem CID | 162184316 |
| Molecular Formula | C13H19ClO2S |
| Molecular Weight | 274.81 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-chloro-1-propan-2-yl-4-(propan-2-ylsulfonylmethyl)benzene |
| SMILES | CC(C)c1ccc(CS(=O)(=O)C(C)C)cc1Cl |
| InChI | InChI=1S/C13H19ClO2S/c1-9(2)12-6-5-11(7-13(12)14)8-17(15,16)10(3)4/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | WKKBNBWFBNLJFR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |