C4H7ClN4 — CID 162186766
6-chloro-4-methyl-1,4-dihydro-1,3,5-triazin-2-amine (PubChem CID 162186766) has the molecular formula C4H7ClN4 and a molecular weight of 146.58 g/mol. Its IUPAC name is 6-chloro-4-methyl-1,4-dihydro-1,3,5-triazin-2-amine.
| Compound Name | 6-chloro-4-methyl-1,4-dihydro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 162186766 |
| Molecular Formula | C4H7ClN4 |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 6-chloro-4-methyl-1,4-dihydro-1,3,5-triazin-2-amine |
| SMILES | CC1N=C(N)NC(Cl)=N1 |
| InChI | InChI=1S/C4H7ClN4/c1-2-7-3(5)9-4(6)8-2/h2H,1H3,(H3,6,7,8,9) |
| InChIKey | ZPTGXEDZKXOQCP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|