C15H27FO4 — CID 162187006
(3R,4S,5R)-3,4-dibutoxy-5-ethyl-5-(fluoromethyl)oxolan-2-one (PubChem CID 162187006) has the molecular formula C15H27FO4 and a molecular weight of 290.37 g/mol. Its IUPAC name is (3R,4S,5R)-3,4-dibutoxy-5-ethyl-5-(fluoromethyl)oxolan-2-one.
| Compound Name | (3R,4S,5R)-3,4-dibutoxy-5-ethyl-5-(fluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 162187006 |
| Molecular Formula | C15H27FO4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3R,4S,5R)-3,4-dibutoxy-5-ethyl-5-(fluoromethyl)oxolan-2-one |
| SMILES | CCCCO[C@H]1C(=O)O[C@@](CC)(CF)[C@H]1OCCCC |
| InChI | InChI=1S/C15H27FO4/c1-4-7-9-18-12-13(19-10-8-5-2)15(6-3,11-16)20-14(12)17/h12-13H,4-11H2,1-3H3/t12-,13+,15+/m1/s1 |
| InChIKey | ZPUBIJVUSOBXCT-IPYPFGDCSA-N |
| XLogP | 3.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|