About methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate
methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate (PubChem CID 162188025) has the molecular formula C18H20ClN3O2
and a molecular weight of 345.83 g/mol. Its IUPAC name is methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate |
| PubChem CID | 162188025 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate |
| SMILES | C.CC(C)OC(=O)c1cnc(Cl)nc1-c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C17H16ClN3O2.CH4/c1-10(2)23-16(22)12-8-19-17(18)20-15(12)13-9-21(3)14-7-5-4-6-11(13)14;/h4-10H,1-3H3;1H4 |
| InChIKey | ZPXMWJWSBCQOPU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate?
The IUPAC name of methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate (CID 162188025) is methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate.
What is the SMILES notation for methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate?
The canonical SMILES for methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate is C.CC(C)OC(=O)c1cnc(Cl)nc1-c1cn(C)c2ccccc12.
What is the InChIKey of methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate?
The InChIKey is ZPXMWJWSBCQOPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O2.CH4/c1-10(2)23-16(22)12-8-19-17(18)20-15(12)13-9-21(3)14-7-5-4-6-11(13)14;/h4-10H,1-3H3;1H4.
What are the key properties of methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate?
methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate has a molecular weight of 345.83 g/mol, XLogP of 4.49, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;propan-2-yl 2-chloro-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate is sourced from PubChem (CID 162188025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).