C16H21NO4 — CID 16218812
(2S)-{[(Benzyloxy)carbonyl]amino}(cyclohexyl)acetic acid (PubChem CID 16218812) has the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetic acid.
| Compound Name | (2S)-{[(Benzyloxy)carbonyl]amino}(cyclohexyl)acetic acid |
|---|---|
| PubChem CID | 16218812 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (2S)-2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetic acid |
| SMILES | C1CCC(CC1)[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
| InChI | InChI=1S/C16H21NO4/c18-15(19)14(13-9-5-2-6-10-13)17-16(20)21-11-12-7-3-1-4-8-12/h1,3-4,7-8,13-14H,2,5-6,9-11H2,(H,17,20)(H,18,19)/t14-/m0/s1 |
| InChIKey | CUSYTUPJAYLNFQ-AWEZNQCLSA-N |
| XLogP | 3.40 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | 346 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |