C20H17F6N3O2 — CID 162188811
2-(trifluoromethyl)phenol;4-[(1R)-1-[2-(trifluoromethyl)phenoxy]ethyl]pyrimidin-2-amine (PubChem CID 162188811) has the molecular formula C20H17F6N3O2 and a molecular weight of 445.36 g/mol. Its IUPAC name is 2-(trifluoromethyl)phenol;4-[(1R)-1-[2-(trifluoromethyl)phenoxy]ethyl]pyrimidin-2-amine.
| Compound Name | 2-(trifluoromethyl)phenol;4-[(1R)-1-[2-(trifluoromethyl)phenoxy]ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 162188811 |
| Molecular Formula | C20H17F6N3O2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-(trifluoromethyl)phenol;4-[(1R)-1-[2-(trifluoromethyl)phenoxy]ethyl]pyrimidin-2-amine |
| SMILES | C[C@@H](Oc1ccccc1C(F)(F)F)c1ccnc(N)n1.Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H12F3N3O.C7H5F3O/c1-8(10-6-7-18-12(17)19-10)20-11-5-3-2-4-9(11)13(14,15)16;8-7(9,10)5-3-1-2-4-6(5)11/h2-8H,1H3,(H2,17,18,19);1-4,11H/t8-;/m1./s1 |
| InChIKey | ZQAFZWCMUVYVNK-DDWIOCJRSA-N |
| XLogP | 5.63 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |