C21H25N3O4S — CID 162190949
2-pyridin-3-ylpropanoic acid;S-[1-(3-pyridin-3-ylpropanoyl)azetidin-3-yl] ethanethioate (PubChem CID 162190949) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-pyridin-3-ylpropanoic acid;S-[1-(3-pyridin-3-ylpropanoyl)azetidin-3-yl] ethanethioate.
| Compound Name | 2-pyridin-3-ylpropanoic acid;S-[1-(3-pyridin-3-ylpropanoyl)azetidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 162190949 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-pyridin-3-ylpropanoic acid;S-[1-(3-pyridin-3-ylpropanoyl)azetidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CN(C(=O)CCc2cccnc2)C1.CC(C(=O)O)c1cccnc1 |
| InChI | InChI=1S/C13H16N2O2S.C8H9NO2/c1-10(16)18-12-8-15(9-12)13(17)5-4-11-3-2-6-14-7-11;1-6(8(10)11)7-3-2-4-9-5-7/h2-3,6-7,12H,4-5,8-9H2,1H3;2-6H,1H3,(H,10,11) |
| InChIKey | ZQHFTDJXUGIVJR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|