About 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol
3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol (PubChem CID 162192027) has the molecular formula C19H41O7S2-
and a molecular weight of 445.66 g/mol. Its IUPAC name is 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol.
Molecular Properties
| Compound Name | 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol |
| PubChem CID | 162192027 |
| Molecular Formula | C19H41O7S2- |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol |
| SMILES | CC(C)CC(=O)[O-].CC(C)CC(O)CS(C)(=O)=O.CC(C)CCCS(C)(=O)=O |
| InChI | InChI=1S/C7H16O3S.C7H16O2S.C5H10O2/c1-6(2)4-7(8)5-11(3,9)10;1-7(2)5-4-6-10(3,8)9;1-4(2)3-5(6)7/h6-8H,4-5H2,1-3H3;7H,4-6H2,1-3H3;4H,3H2,1-2H3,(H,6,7)/p-1 |
| InChIKey | ZQKVMMFEEIXMLB-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol?
The IUPAC name of 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol (CID 162192027) is 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol.
What is the SMILES notation for 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol?
The canonical SMILES for 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol is CC(C)CC(=O)[O-].CC(C)CC(O)CS(C)(=O)=O.CC(C)CCCS(C)(=O)=O.
What is the InChIKey of 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol?
The InChIKey is ZQKVMMFEEIXMLB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16O3S.C7H16O2S.C5H10O2/c1-6(2)4-7(8)5-11(3,9)10;1-7(2)5-4-6-10(3,8)9;1-4(2)3-5(6)7/h6-8H,4-5H2,1-3H3;7H,4-6H2,1-3H3;4H,3H2,1-2H3,(H,6,7)/p-1.
What are the key properties of 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol?
3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol has a molecular weight of 445.66 g/mol, XLogP of 1.69, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanoate;4-methyl-1-methylsulfonylpentane;4-methyl-1-methylsulfonylpentan-2-ol is sourced from PubChem (CID 162192027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).