About 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide
6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide (PubChem CID 162193317) has the molecular formula C15H15ClF2N2O2
and a molecular weight of 328.75 g/mol. Its IUPAC name is 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide |
| PubChem CID | 162193317 |
| Molecular Formula | C15H15ClF2N2O2 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc2c(CCCC(=O)C(F)F)c(C(N)=O)[nH]c2cc1Cl |
| InChI | InChI=1S/C15H15ClF2N2O2/c1-7-5-9-8(3-2-4-12(21)14(17)18)13(15(19)22)20-11(9)6-10(7)16/h5-6,14,20H,2-4H2,1H3,(H2,19,22) |
| InChIKey | ZQPMLSGTKTVDNQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide?
The IUPAC name of 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide (CID 162193317) is 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide.
What is the SMILES notation for 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide?
The canonical SMILES for 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide is Cc1cc2c(CCCC(=O)C(F)F)c(C(N)=O)[nH]c2cc1Cl.
What is the InChIKey of 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide?
The InChIKey is ZQPMLSGTKTVDNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClF2N2O2/c1-7-5-9-8(3-2-4-12(21)14(17)18)13(15(19)22)20-11(9)6-10(7)16/h5-6,14,20H,2-4H2,1H3,(H2,19,22).
What are the key properties of 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide?
6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide has a molecular weight of 328.75 g/mol, XLogP of 3.39, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(5,5-difluoro-4-oxopentyl)-5-methyl-1H-indole-2-carboxamide is sourced from PubChem (CID 162193317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).