About 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate
1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate (PubChem CID 162193860) has the molecular formula C18H36N4O4
and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate.
Molecular Properties
| Compound Name | 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate |
| PubChem CID | 162193860 |
| Molecular Formula | C18H36N4O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCNCC1.NC1CCN(C(=O)CCO)CC1 |
| InChI | InChI=1S/C10H20N2O2.C8H16N2O2/c1-10(2,3)14-9(13)12-8-4-6-11-7-5-8;9-7-1-4-10(5-2-7)8(12)3-6-11/h8,11H,4-7H2,1-3H3,(H,12,13);7,11H,1-6,9H2 |
| InChIKey | ZQRIMXWJTDACDL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate?
The IUPAC name of 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate (CID 162193860) is 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate.
What is the SMILES notation for 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate?
The canonical SMILES for 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate is CC(C)(C)OC(=O)NC1CCNCC1.NC1CCN(C(=O)CCO)CC1.
What is the InChIKey of 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate?
The InChIKey is ZQRIMXWJTDACDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2.C8H16N2O2/c1-10(2,3)14-9(13)12-8-4-6-11-7-5-8;9-7-1-4-10(5-2-7)8(12)3-6-11/h8,11H,4-7H2,1-3H3,(H,12,13);7,11H,1-6,9H2.
What are the key properties of 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate?
1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate has a molecular weight of 372.51 g/mol, XLogP of 0.58, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminopiperidin-1-yl)-3-hydroxypropan-1-one;tert-butyl N-piperidin-4-ylcarbamate is sourced from PubChem (CID 162193860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).