About 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one
1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one (PubChem CID 162194518) has the molecular formula C15H11F5N2OS2
and a molecular weight of 394.39 g/mol. Its IUPAC name is 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one.
Molecular Properties
| Compound Name | 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one |
| PubChem CID | 162194518 |
| Molecular Formula | C15H11F5N2OS2 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one |
| SMILES | O=C(Cc1ccc(S(F)(F)(F)(F)F)cc1)Cc1ccc2nnsc2c1 |
| InChI | InChI=1S/C15H11F5N2OS2/c16-25(17,18,19,20)13-4-1-10(2-5-13)7-12(23)8-11-3-6-14-15(9-11)24-22-21-14/h1-6,9H,7-8H2 |
| InChIKey | YHGINIAHSKAUJZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one?
The IUPAC name of 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one (CID 162194518) is 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one.
What is the SMILES notation for 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one?
The canonical SMILES for 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one is O=C(Cc1ccc(S(F)(F)(F)(F)F)cc1)Cc1ccc2nnsc2c1.
What is the InChIKey of 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one?
The InChIKey is YHGINIAHSKAUJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F5N2OS2/c16-25(17,18,19,20)13-4-1-10(2-5-13)7-12(23)8-11-3-6-14-15(9-11)24-22-21-14/h1-6,9H,7-8H2.
What are the key properties of 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one?
1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one has a molecular weight of 394.39 g/mol, XLogP of 5.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,3-benzothiadiazol-6-yl)-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-one is sourced from PubChem (CID 162194518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).