C16H26BO4P — CID 162194609
2-[2-[[ethoxy(methyl)phosphoryl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162194609) has the molecular formula C16H26BO4P and a molecular weight of 324.17 g/mol. Its IUPAC name is 2-[2-[[ethoxy(methyl)phosphoryl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-[[ethoxy(methyl)phosphoryl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162194609 |
| Molecular Formula | C16H26BO4P |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[2-[[ethoxy(methyl)phosphoryl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOP(C)(=O)Cc1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H26BO4P/c1-7-19-22(6,18)12-13-10-8-9-11-14(13)17-20-15(2,3)16(4,5)21-17/h8-11H,7,12H2,1-6H3 |
| InChIKey | ZQTUDBNLOHCVTF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|