C20H24FN2O8P — CID 162195293
1-[(2R,3R,4S,5S)-2-deuterio-5-[dideuterio-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one (PubChem CID 162195293) has the molecular formula C20H24FN2O8P and a molecular weight of 473.41 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-2-deuterio-5-[dideuterio-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,3R,4S,5S)-2-deuterio-5-[dideuterio-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 162195293 |
| Molecular Formula | C20H24FN2O8P |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-2-deuterio-5-[dideuterio-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one |
| SMILES | [2H]C([2H])(OP1(=O)OCc2cc(C)cc(C)c2O1)[C@@]1(F)O[C@@]([2H])(N2C=C(C)C(=O)NC2=C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24FN2O8P/c1-10-5-11(2)16-14(6-10)8-28-32(27,31-16)29-9-20(21)17(25)15(24)19(30-20)23-7-12(3)18(26)22-13(23)4/h5-7,15,17,19,24-25H,4,8-9H2,1-3H3,(H,22,26)/t15-,17+,19-,20-,32?/m1/s1/i9D2,19D |
| InChIKey | BBRQAUKCQCYFCM-XLKZCAJWSA-N |
| XLogP | 1.89 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|