C10H14F3N3O3 — CID 162196459
5-amino-2-methyl-3-prop-2-enylpyrimidin-4-one;molecular hydrogen;2,2,2-trifluoroacetic acid (PubChem CID 162196459) has the molecular formula C10H14F3N3O3 and a molecular weight of 281.23 g/mol. Its IUPAC name is 5-amino-2-methyl-3-prop-2-enylpyrimidin-4-one;molecular hydrogen;2,2,2-trifluoroacetic acid.
| Compound Name | 5-amino-2-methyl-3-prop-2-enylpyrimidin-4-one;molecular hydrogen;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162196459 |
| Molecular Formula | C10H14F3N3O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-amino-2-methyl-3-prop-2-enylpyrimidin-4-one;molecular hydrogen;2,2,2-trifluoroacetic acid |
| SMILES | C=CCn1c(C)ncc(N)c1=O.O=C(O)C(F)(F)F.[H][H] |
| InChI | InChI=1S/C8H11N3O.C2HF3O2.H2/c1-3-4-11-6(2)10-5-7(9)8(11)12;3-2(4,5)1(6)7;/h3,5H,1,4,9H2,2H3;(H,6,7);1H |
| InChIKey | ZAYSRGAJRXZVPH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|