C18H40N2 — CID 162197438
N'-(2-methylundecan-2-yl)-N'-propylpropane-1,3-diamine (PubChem CID 162197438) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is N'-(2-methylundecan-2-yl)-N'-propylpropane-1,3-diamine.
| Compound Name | N'-(2-methylundecan-2-yl)-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 162197438 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | N'-(2-methylundecan-2-yl)-N'-propylpropane-1,3-diamine |
| SMILES | CCCCCCCCCC(C)(C)N(CCC)CCCN |
| InChI | InChI=1S/C18H40N2/c1-5-7-8-9-10-11-12-14-18(3,4)20(16-6-2)17-13-15-19/h5-17,19H2,1-4H3 |
| InChIKey | ZRDCWVPQTMKZPB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|