C31H30O5 — CID 162198001
3,3-dimethyl-2,4-dihydro-1H-phenanthrene-9,10-dione;4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione (PubChem CID 162198001) has the molecular formula C31H30O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydro-1H-phenanthrene-9,10-dione;4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione.
| Compound Name | 3,3-dimethyl-2,4-dihydro-1H-phenanthrene-9,10-dione;4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 162198001 |
| Molecular Formula | C31H30O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydro-1H-phenanthrene-9,10-dione;4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione |
| SMILES | CC(C)=CCC1=C(O)c2ccccc2C(=O)C1=O.CC1(C)CCC2=C(C1)c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C16H16O2.C15H14O3/c1-16(2)8-7-12-13(9-16)10-5-3-4-6-11(10)14(17)15(12)18;1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18/h3-6H,7-9H2,1-2H3;3-7,16H,8H2,1-2H3 |
| InChIKey | RVOLRWIQVWRIGO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|