About 2-amino-5-chlorophenol
2-amino-5-chlorophenol (PubChem CID 162200798) has the molecular formula C12H12Cl2N2O2
and a molecular weight of 287.15 g/mol. Its IUPAC name is 2-amino-5-chlorophenol.
Molecular Properties
| Compound Name | 2-amino-5-chlorophenol |
| PubChem CID | 162200798 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-amino-5-chlorophenol |
| SMILES | Nc1ccc(Cl)cc1O.Nc1ccc(Cl)cc1O |
| InChI | InChI=1S/2C6H6ClNO/c2*7-4-1-2-5(8)6(9)3-4/h2*1-3,9H,8H2 |
| InChIKey | ZROBSJCVITWDFV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-chlorophenol?
The IUPAC name of 2-amino-5-chlorophenol (CID 162200798) is 2-amino-5-chlorophenol.
What is the SMILES notation for 2-amino-5-chlorophenol?
The canonical SMILES for 2-amino-5-chlorophenol is Nc1ccc(Cl)cc1O.Nc1ccc(Cl)cc1O.
What is the InChIKey of 2-amino-5-chlorophenol?
The InChIKey is ZROBSJCVITWDFV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6ClNO/c2*7-4-1-2-5(8)6(9)3-4/h2*1-3,9H,8H2.
What are the key properties of 2-amino-5-chlorophenol?
2-amino-5-chlorophenol has a molecular weight of 287.15 g/mol, XLogP of 3.26, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-chlorophenol is sourced from PubChem (CID 162200798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).