C27H32N2O6 — CID 162200926
methyl 6-(2-oxopropyl)-1,2,3,4-tetrahydroquinoline-4-carboxylate;6-(2-oxopropyl)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (PubChem CID 162200926) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is methyl 6-(2-oxopropyl)-1,2,3,4-tetrahydroquinoline-4-carboxylate;6-(2-oxopropyl)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid.
| Compound Name | methyl 6-(2-oxopropyl)-1,2,3,4-tetrahydroquinoline-4-carboxylate;6-(2-oxopropyl)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 162200926 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | methyl 6-(2-oxopropyl)-1,2,3,4-tetrahydroquinoline-4-carboxylate;6-(2-oxopropyl)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| SMILES | CC(=O)Cc1ccc2c(c1)C(C(=O)O)CCN2.COC(=O)C1CCNc2ccc(CC(C)=O)cc21 |
| InChI | InChI=1S/C14H17NO3.C13H15NO3/c1-9(16)7-10-3-4-13-12(8-10)11(5-6-15-13)14(17)18-2;1-8(15)6-9-2-3-12-11(7-9)10(13(16)17)4-5-14-12/h3-4,8,11,15H,5-7H2,1-2H3;2-3,7,10,14H,4-6H2,1H3,(H,16,17) |
| InChIKey | ZROLWKFTGWFJEF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |