About hydrazine;sulfosulfonyloxymethane
hydrazine;sulfosulfonyloxymethane (PubChem CID 162202449) has the molecular formula CH8N2O6S2
and a molecular weight of 208.22 g/mol. Its IUPAC name is hydrazine;sulfosulfonyloxymethane.
Molecular Properties
| Compound Name | hydrazine;sulfosulfonyloxymethane |
| PubChem CID | 162202449 |
| Molecular Formula | CH8N2O6S2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | hydrazine;sulfosulfonyloxymethane |
| SMILES | COS(=O)(=O)S(=O)(=O)O.NN |
| InChI | InChI=1S/CH4O6S2.H4N2/c1-7-9(5,6)8(2,3)4;1-2/h1H3,(H,2,3,4);1-2H2 |
| InChIKey | ZRTODOAMZQIJPF-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;sulfosulfonyloxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;sulfosulfonyloxymethane?
The IUPAC name of hydrazine;sulfosulfonyloxymethane (CID 162202449) is hydrazine;sulfosulfonyloxymethane.
What is the SMILES notation for hydrazine;sulfosulfonyloxymethane?
The canonical SMILES for hydrazine;sulfosulfonyloxymethane is COS(=O)(=O)S(=O)(=O)O.NN.
What is the InChIKey of hydrazine;sulfosulfonyloxymethane?
The InChIKey is ZRTODOAMZQIJPF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O6S2.H4N2/c1-7-9(5,6)8(2,3)4;1-2/h1H3,(H,2,3,4);1-2H2.
What are the key properties of hydrazine;sulfosulfonyloxymethane?
hydrazine;sulfosulfonyloxymethane has a molecular weight of 208.22 g/mol, XLogP of -2.42, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;sulfosulfonyloxymethane is sourced from PubChem (CID 162202449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).