About 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium
2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium (PubChem CID 162202806) has the molecular formula C12H13N2+
and a molecular weight of 185.25 g/mol. Its IUPAC name is 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium.
Molecular Properties
| Compound Name | 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium |
| PubChem CID | 162202806 |
| Molecular Formula | C12H13N2+ |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium |
| SMILES | Cc1cc2c(n1C)=CC1C=CC=C[N+]=21 |
| InChI | InChI=1S/C12H13N2/c1-9-7-12-11(13(9)2)8-10-5-3-4-6-14(10)12/h3-8,10H,1-2H3/q+1 |
| InChIKey | YASNPMBYWJDPLR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium?
The IUPAC name of 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium (CID 162202806) is 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium.
What is the SMILES notation for 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium?
The canonical SMILES for 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium is Cc1cc2c(n1C)=CC1C=CC=C[N+]=21.
What is the InChIKey of 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium?
The InChIKey is YASNPMBYWJDPLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N2/c1-9-7-12-11(13(9)2)8-10-5-3-4-6-14(10)12/h3-8,10H,1-2H3/q+1.
What are the key properties of 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium?
2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium has a molecular weight of 185.25 g/mol, XLogP of 0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4aH-pyrrolo[2,3-b]indolizin-9-ium is sourced from PubChem (CID 162202806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).