About (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol
(2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol (PubChem CID 162203025) has the molecular formula C30H29ClO4
and a molecular weight of 489.01 g/mol. Its IUPAC name is (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol.
Molecular Properties
| Compound Name | (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol |
| PubChem CID | 162203025 |
| Molecular Formula | C30H29ClO4 |
| Molecular Weight | 489.01 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol |
| SMILES | Cc1cccc(C(=O)Cl)c1.Cc1cccc(C(=O)c2ccc(C)cc2O)c1.Cc1cccc(O)c1 |
| InChI | InChI=1S/C15H14O2.C8H7ClO.C7H8O/c1-10-4-3-5-12(8-10)15(17)13-7-6-11(2)9-14(13)16;1-6-3-2-4-7(5-6)8(9)10;1-6-3-2-4-7(8)5-6/h3-9,16H,1-2H3;2-5H,1H3;2-5,8H,1H3 |
| InChIKey | ZRVGQNXPINZVEO-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.01 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol?
The IUPAC name of (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol (CID 162203025) is (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol.
What is the SMILES notation for (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol?
The canonical SMILES for (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol is Cc1cccc(C(=O)Cl)c1.Cc1cccc(C(=O)c2ccc(C)cc2O)c1.Cc1cccc(O)c1.
What is the InChIKey of (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol?
The InChIKey is ZRVGQNXPINZVEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2.C8H7ClO.C7H8O/c1-10-4-3-5-12(8-10)15(17)13-7-6-11(2)9-14(13)16;1-6-3-2-4-7(5-6)8(9)10;1-6-3-2-4-7(8)5-6/h3-9,16H,1-2H3;2-5H,1H3;2-5,8H,1H3.
What are the key properties of (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol?
(2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol has a molecular weight of 489.01 g/mol, XLogP of 7.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-4-methylphenyl)-(3-methylphenyl)methanone;3-methylbenzoyl chloride;3-methylphenol is sourced from PubChem (CID 162203025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).