About [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide
[2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide (PubChem CID 162205883) has the molecular formula C8H14F4N-
and a molecular weight of 200.20 g/mol. Its IUPAC name is [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide.
Molecular Properties
| Compound Name | [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide |
| PubChem CID | 162205883 |
| Molecular Formula | C8H14F4N- |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide |
| SMILES | CC[N-]CC(CC(F)F)CC(F)F |
| InChI | InChI=1S/C8H14F4N/c1-2-13-5-6(3-7(9)10)4-8(11)12/h6-8H,2-5H2,1H3/q-1 |
| InChIKey | ZSEJHGPSTDYKEN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide?
The IUPAC name of [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide (CID 162205883) is [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide.
What is the SMILES notation for [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide?
The canonical SMILES for [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide is CC[N-]CC(CC(F)F)CC(F)F.
What is the InChIKey of [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide?
The InChIKey is ZSEJHGPSTDYKEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F4N/c1-2-13-5-6(3-7(9)10)4-8(11)12/h6-8H,2-5H2,1H3/q-1.
What are the key properties of [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide?
[2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide has a molecular weight of 200.20 g/mol, XLogP of 3.31, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-difluoroethyl)-4,4-difluorobutyl]-ethylazanide is sourced from PubChem (CID 162205883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).