C20H22F4N6O3 — CID 162205894
(3R,6S)-3-(cyclopropylmethyl)-2,5-dioxo-7-(2H-tetrazol-5-yl)-6-[[(1S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethyl]amino]heptanamide (PubChem CID 162205894) has the molecular formula C20H22F4N6O3 and a molecular weight of 470.43 g/mol. Its IUPAC name is (3R,6S)-3-(cyclopropylmethyl)-2,5-dioxo-7-(2H-tetrazol-5-yl)-6-[[(1S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethyl]amino]heptanamide.
| Compound Name | (3R,6S)-3-(cyclopropylmethyl)-2,5-dioxo-7-(2H-tetrazol-5-yl)-6-[[(1S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethyl]amino]heptanamide |
|---|---|
| PubChem CID | 162205894 |
| Molecular Formula | C20H22F4N6O3 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (3R,6S)-3-(cyclopropylmethyl)-2,5-dioxo-7-(2H-tetrazol-5-yl)-6-[[(1S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethyl]amino]heptanamide |
| SMILES | NC(=O)C(=O)[C@@H](CC(=O)[C@H](Cc1nn[nH]n1)N[C@@H](c1ccccc1F)C(F)(F)F)CC1CC1 |
| InChI | InChI=1S/C20H22F4N6O3/c21-13-4-2-1-3-12(13)18(20(22,23)24)26-14(9-16-27-29-30-28-16)15(31)8-11(7-10-5-6-10)17(32)19(25)33/h1-4,10-11,14,18,26H,5-9H2,(H2,25,33)(H,27,28,29,30)/t11-,14+,18+/m1/s1 |
| InChIKey | NFZRGZCKLSYDSZ-VZSAFFHGSA-N |
| XLogP | 1.57 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|