C15H12Cl3F18NO2S2 — CID 162206299
3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexane-1-sulfonyl chloride;[3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexyl] thiocyanate;molecular chlorine (PubChem CID 162206299) has the molecular formula C15H12Cl3F18NO2S2 and a molecular weight of 750.72 g/mol. Its IUPAC name is 3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexane-1-sulfonyl chloride;[3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexyl] thiocyanate;molecular chlorine.
| Compound Name | 3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexane-1-sulfonyl chloride;[3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexyl] thiocyanate;molecular chlorine |
|---|---|
| PubChem CID | 162206299 |
| Molecular Formula | C15H12Cl3F18NO2S2 |
| Molecular Weight | 750.72 g/mol |
| Exact Mass | 748.91 |
| IUPAC Name | 3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexane-1-sulfonyl chloride;[3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexyl] thiocyanate;molecular chlorine |
| SMILES | ClCl.N#CSCCC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F.O=S(=O)(Cl)CCC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F9NS.C7H6ClF9O2S.Cl2/c9-5(10,1-2-19-4-18)3-6(11,7(12,13)14)8(15,16)17;8-20(18,19)2-1-4(9,10)3-5(11,6(12,13)14)7(15,16)17;1-2/h1-3H2;1-3H2; |
| InChIKey | ZSFTXDPCGSJDKE-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.72 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|