C23H19Cl2N3O6 — CID 162206449
ethyl 2,3-dichloroquinoxaline-6-carboxylate;ethyl 2,3-dioxo-1,4-dihydroquinoline-6-carboxylate (PubChem CID 162206449) has the molecular formula C23H19Cl2N3O6 and a molecular weight of 504.33 g/mol. Its IUPAC name is ethyl 2,3-dichloroquinoxaline-6-carboxylate;ethyl 2,3-dioxo-1,4-dihydroquinoline-6-carboxylate.
| Compound Name | ethyl 2,3-dichloroquinoxaline-6-carboxylate;ethyl 2,3-dioxo-1,4-dihydroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 162206449 |
| Molecular Formula | C23H19Cl2N3O6 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | ethyl 2,3-dichloroquinoxaline-6-carboxylate;ethyl 2,3-dioxo-1,4-dihydroquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)CC(=O)C(=O)N2.CCOC(=O)c1ccc2nc(Cl)c(Cl)nc2c1 |
| InChI | InChI=1S/C12H11NO4.C11H8Cl2N2O2/c1-2-17-12(16)7-3-4-9-8(5-7)6-10(14)11(15)13-9;1-2-17-11(16)6-3-4-7-8(5-6)15-10(13)9(12)14-7/h3-5H,2,6H2,1H3,(H,13,15);3-5H,2H2,1H3 |
| InChIKey | ZSGHNFMNTXHQDL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|