About (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane
(1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane (PubChem CID 162207968) has the molecular formula C7H17F2NS
and a molecular weight of 185.28 g/mol. Its IUPAC name is (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane.
Molecular Properties
| Compound Name | (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane |
| PubChem CID | 162207968 |
| Molecular Formula | C7H17F2NS |
| Molecular Weight | 185.28 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane |
| SMILES | C.N[C@H]1CCCC(F)(F)C1.S |
| InChI | InChI=1S/C6H11F2N.CH4.H2S/c7-6(8)3-1-2-5(9)4-6;;/h5H,1-4,9H2;1H4;1H2/t5-;;/m0../s1 |
| InChIKey | ZSLOHBIKOBQJNN-XRIGFGBMSA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane?
The IUPAC name of (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane (CID 162207968) is (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane.
What is the SMILES notation for (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane?
The canonical SMILES for (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane is C.N[C@H]1CCCC(F)(F)C1.S.
What is the InChIKey of (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane?
The InChIKey is ZSLOHBIKOBQJNN-XRIGFGBMSA-N. The full InChI is InChI=1S/C6H11F2N.CH4.H2S/c7-6(8)3-1-2-5(9)4-6;;/h5H,1-4,9H2;1H4;1H2/t5-;;/m0../s1.
What are the key properties of (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane?
(1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane has a molecular weight of 185.28 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3,3-difluorocyclohexan-1-amine;methane;sulfane is sourced from PubChem (CID 162207968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).