C5H8F3N3O5S — CID 162208789
(2,5-dioxopyrrolidin-3-yl) trifluoromethanesulfonate;hydrazine (PubChem CID 162208789) has the molecular formula C5H8F3N3O5S and a molecular weight of 279.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-3-yl) trifluoromethanesulfonate;hydrazine.
| Compound Name | (2,5-dioxopyrrolidin-3-yl) trifluoromethanesulfonate;hydrazine |
|---|---|
| PubChem CID | 162208789 |
| Molecular Formula | C5H8F3N3O5S |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-3-yl) trifluoromethanesulfonate;hydrazine |
| SMILES | NN.O=C1CC(OS(=O)(=O)C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C5H4F3NO5S.H4N2/c6-5(7,8)15(12,13)14-2-1-3(10)9-4(2)11;1-2/h2H,1H2,(H,9,10,11);1-2H2 |
| InChIKey | ZSODLUWWIQVJLZ-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|