About 3H-1,3-benzothiazole-2-thione;thiadiazole
3H-1,3-benzothiazole-2-thione;thiadiazole (PubChem CID 162210790) has the molecular formula C9H7N3S3
and a molecular weight of 253.38 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;thiadiazole.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;thiadiazole |
| PubChem CID | 162210790 |
| Molecular Formula | C9H7N3S3 |
| Molecular Weight | 253.38 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;thiadiazole |
| SMILES | S=c1[nH]c2ccccc2s1.c1csnn1 |
| InChI | InChI=1S/C7H5NS2.C2H2N2S/c9-7-8-5-3-1-2-4-6(5)10-7;1-2-5-4-3-1/h1-4H,(H,8,9);1-2H |
| InChIKey | ZSUVUVWHMHIGFX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;thiadiazole?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;thiadiazole (CID 162210790) is 3H-1,3-benzothiazole-2-thione;thiadiazole.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;thiadiazole?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;thiadiazole is S=c1[nH]c2ccccc2s1.c1csnn1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;thiadiazole?
The InChIKey is ZSUVUVWHMHIGFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C2H2N2S/c9-7-8-5-3-1-2-4-6(5)10-7;1-2-5-4-3-1/h1-4H,(H,8,9);1-2H.
What are the key properties of 3H-1,3-benzothiazole-2-thione;thiadiazole?
3H-1,3-benzothiazole-2-thione;thiadiazole has a molecular weight of 253.38 g/mol, XLogP of 3.50, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;thiadiazole is sourced from PubChem (CID 162210790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).