About 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane
2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane (PubChem CID 162211008) has the molecular formula C12H15Cl2NO2S
and a molecular weight of 308.23 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane.
Molecular Properties
| Compound Name | 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane |
| PubChem CID | 162211008 |
| Molecular Formula | C12H15Cl2NO2S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane |
| SMILES | CCS(=O)(=O)CC.N#CCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H5Cl2N.C4H10O2S/c9-7-3-6(1-2-11)4-8(10)5-7;1-3-7(5,6)4-2/h3-5H,1H2;3-4H2,1-2H3 |
| InChIKey | ZSVPTEXUNYIWMK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane?
The IUPAC name of 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane (CID 162211008) is 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane.
What is the SMILES notation for 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane?
The canonical SMILES for 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane is CCS(=O)(=O)CC.N#CCc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane?
The InChIKey is ZSVPTEXUNYIWMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2N.C4H10O2S/c9-7-3-6(1-2-11)4-8(10)5-7;1-3-7(5,6)4-2/h3-5H,1H2;3-4H2,1-2H3.
What are the key properties of 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane?
2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane has a molecular weight of 308.23 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dichlorophenyl)acetonitrile;1-ethylsulfonylethane is sourced from PubChem (CID 162211008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).