About ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid
ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid (PubChem CID 162213020) has the molecular formula C16H30N2O4
and a molecular weight of 314.43 g/mol. Its IUPAC name is ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid |
| PubChem CID | 162213020 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid |
| SMILES | CCN1CCCC(C(=O)O)C1.CCOC(=O)C1CCCNC1 |
| InChI | InChI=1S/2C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7;1-2-9-5-3-4-7(6-9)8(10)11/h7,9H,2-6H2,1H3;7H,2-6H2,1H3,(H,10,11) |
| InChIKey | ZTCISUWBWFVAJF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid?
The IUPAC name of ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid (CID 162213020) is ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid.
What is the SMILES notation for ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid?
The canonical SMILES for ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid is CCN1CCCC(C(=O)O)C1.CCOC(=O)C1CCCNC1.
What is the InChIKey of ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid?
The InChIKey is ZTCISUWBWFVAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7;1-2-9-5-3-4-7(6-9)8(10)11/h7,9H,2-6H2,1H3;7H,2-6H2,1H3,(H,10,11).
What are the key properties of ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid?
ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid has a molecular weight of 314.43 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid is sourced from PubChem (CID 162213020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).