ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid

C16H30N2O4 — CID 162213020

IUPACethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid
SMILESCCN1CCCC(C(=O)O)C1.CCOC(=O)C1CCCNC1
InChIInChI=1S/2C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7;1-2-9-5-3-4-7(6-9)8(10)11/h7,9H,2-6H2,1H3;7H,2-6H2,1H3,(H,10,11)
InChIKeyZTCISUWBWFVAJF-UHFFFAOYSA-N
MW314.43 g/mol
LogP1.35
Rot. Bonds4

About ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid

ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid (PubChem CID 162213020) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid.

Molecular Properties

Compound Nameethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid
PubChem CID162213020
Molecular FormulaC16H30N2O4
Molecular Weight314.43 g/mol
Exact Mass314.22
IUPAC Nameethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid
SMILESCCN1CCCC(C(=O)O)C1.CCOC(=O)C1CCCNC1
InChIInChI=1S/2C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7;1-2-9-5-3-4-7(6-9)8(10)11/h7,9H,2-6H2,1H3;7H,2-6H2,1H3,(H,10,11)
InChIKeyZTCISUWBWFVAJF-UHFFFAOYSA-N
XLogP1.35
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.43
LogP ≤ 51.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid?
The IUPAC name of ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid (CID 162213020) is ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid.
What is the SMILES notation for ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid?
The canonical SMILES for ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid is CCN1CCCC(C(=O)O)C1.CCOC(=O)C1CCCNC1.
What is the InChIKey of ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid?
The InChIKey is ZTCISUWBWFVAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7;1-2-9-5-3-4-7(6-9)8(10)11/h7,9H,2-6H2,1H3;7H,2-6H2,1H3,(H,10,11).
What are the key properties of ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid?
ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid has a molecular weight of 314.43 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl piperidine-3-carboxylate;1-ethylpiperidine-3-carboxylic acid is sourced from PubChem (CID 162213020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).