C21H33BN2O2S — CID 162213419
(3R,8aS)-2-benzyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,6,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine;sulfane (PubChem CID 162213419) has the molecular formula C21H33BN2O2S and a molecular weight of 388.39 g/mol. Its IUPAC name is (3R,8aS)-2-benzyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,6,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine;sulfane.
| Compound Name | (3R,8aS)-2-benzyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,6,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine;sulfane |
|---|---|
| PubChem CID | 162213419 |
| Molecular Formula | C21H33BN2O2S |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (3R,8aS)-2-benzyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,6,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine;sulfane |
| SMILES | C[C@@H]1CN2CC(B3OC(C)(C)C(C)(C)O3)=C[C@H]2CN1Cc1ccccc1.S |
| InChI | InChI=1S/C21H31BN2O2.H2S/c1-16-12-24-14-18(22-25-20(2,3)21(4,5)26-22)11-19(24)15-23(16)13-17-9-7-6-8-10-17;/h6-11,16,19H,12-15H2,1-5H3;1H2/t16-,19+;/m1./s1 |
| InChIKey | ZTDVFUBWSNOUBV-VWJDFLIZSA-N |
| XLogP | 3.25 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|