About 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal
3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal (PubChem CID 162213791) has the molecular formula C17H16O5
and a molecular weight of 300.31 g/mol. Its IUPAC name is 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal.
Molecular Properties
| Compound Name | 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal |
| PubChem CID | 162213791 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal |
| SMILES | Cc1ccc(/C=C/C=O)cc1O.O=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H10O2.C7H6O3/c1-8-4-5-9(3-2-6-11)7-10(8)12;8-4-5-1-2-6(9)7(10)3-5/h2-7,12H,1H3;1-4,9-10H/b3-2+; |
| InChIKey | ZTEYGEFBJCGPDY-SQQVDAMQSA-N |
| XLogP | 2.82 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal?
The IUPAC name of 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal (CID 162213791) is 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal.
What is the SMILES notation for 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal?
The canonical SMILES for 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal is Cc1ccc(/C=C/C=O)cc1O.O=Cc1ccc(O)c(O)c1.
What is the InChIKey of 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal?
The InChIKey is ZTEYGEFBJCGPDY-SQQVDAMQSA-N. The full InChI is InChI=1S/C10H10O2.C7H6O3/c1-8-4-5-9(3-2-6-11)7-10(8)12;8-4-5-1-2-6(9)7(10)3-5/h2-7,12H,1H3;1-4,9-10H/b3-2+;.
What are the key properties of 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal?
3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal has a molecular weight of 300.31 g/mol, XLogP of 2.82, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxybenzaldehyde;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enal is sourced from PubChem (CID 162213791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).