C41H69N5O12 — CID 162213829
9-[2-[2-[6-[acetyl-[3-(2-ethoxyethoxy)propyl]amino]-5-oxohexoxy]ethoxy]ethoxy]-2-[9-(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]-5-oxononanoic acid (PubChem CID 162213829) has the molecular formula C41H69N5O12 and a molecular weight of 824.03 g/mol. Its IUPAC name is 9-[2-[2-[6-[acetyl-[3-(2-ethoxyethoxy)propyl]amino]-5-oxohexoxy]ethoxy]ethoxy]-2-[9-(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]-5-oxononanoic acid.
| Compound Name | 9-[2-[2-[6-[acetyl-[3-(2-ethoxyethoxy)propyl]amino]-5-oxohexoxy]ethoxy]ethoxy]-2-[9-(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]-5-oxononanoic acid |
|---|---|
| PubChem CID | 162213829 |
| Molecular Formula | C41H69N5O12 |
| Molecular Weight | 824.03 g/mol |
| Exact Mass | 823.49 |
| IUPAC Name | 9-[2-[2-[6-[acetyl-[3-(2-ethoxyethoxy)propyl]amino]-5-oxohexoxy]ethoxy]ethoxy]-2-[9-(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]-5-oxononanoic acid |
| SMILES | CCOCCOCCCN(CC(=O)CCCCOCCOCCOCCCCC(=O)CCC(C(=O)O)N1CCNCCN(CC(=O)O)Cc2cccc(n2)C1)C(C)=O |
| InChI | InChI=1S/C41H69N5O12/c1-3-54-24-25-57-23-9-18-45(34(2)47)32-38(49)13-5-7-22-56-27-29-58-28-26-55-21-6-4-12-37(48)14-15-39(41(52)53)46-20-17-42-16-19-44(33-40(50)51)30-35-10-8-11-36(31-46)43-35/h8,10-11,39,42H,3-7,9,12-33H2,1-2H3,(H,50,51)(H,52,53) |
| InChIKey | MICMCEJLWUKTNO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 206.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.03 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|