About CID 162214649
CID 162214649 (PubChem CID 162214649) has the molecular formula C13H13BrO2S2
and a molecular weight of 345.28 g/mol.
Molecular Properties
| Compound Name | CID 162214649 |
| PubChem CID | 162214649 |
| Molecular Formula | C13H13BrO2S2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | — |
| SMILES | Cc1ccc(O)cc1.Oc1ccc(Br)cc1.S=S |
| InChI | InChI=1S/C7H8O.C6H5BrO.S2/c1-6-2-4-7(8)5-3-6;7-5-1-3-6(8)4-2-5;1-2/h2-5,8H,1H3;1-4,8H; |
| InChIKey | ZTHLBBMMZQFAFA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 162214649 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162214649?
The IUPAC name of CID 162214649 (CID 162214649) is not available.
What is the SMILES notation for CID 162214649?
The canonical SMILES for CID 162214649 is Cc1ccc(O)cc1.Oc1ccc(Br)cc1.S=S.
What is the InChIKey of CID 162214649?
The InChIKey is ZTHLBBMMZQFAFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H5BrO.S2/c1-6-2-4-7(8)5-3-6;7-5-1-3-6(8)4-2-5;1-2/h2-5,8H,1H3;1-4,8H;.
What are the key properties of CID 162214649?
CID 162214649 has a molecular weight of 345.28 g/mol, XLogP of 3.85, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162214649 is sourced from PubChem (CID 162214649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).