About 2-oxobut-3-enyl hypofluorite
2-oxobut-3-enyl hypofluorite (PubChem CID 162215106) has the molecular formula C4H5FO2
and a molecular weight of 104.08 g/mol. Its IUPAC name is 2-oxobut-3-enyl hypofluorite.
Molecular Properties
| Compound Name | 2-oxobut-3-enyl hypofluorite |
| PubChem CID | 162215106 |
| Molecular Formula | C4H5FO2 |
| Molecular Weight | 104.08 g/mol |
| Exact Mass | 104.03 |
| IUPAC Name | 2-oxobut-3-enyl hypofluorite |
| SMILES | C=CC(=O)COF |
| InChI | InChI=1S/C4H5FO2/c1-2-4(6)3-7-5/h2H,1,3H2 |
| InChIKey | FOCKFIIECUQEOA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.08 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxobut-3-enyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxobut-3-enyl hypofluorite?
The IUPAC name of 2-oxobut-3-enyl hypofluorite (CID 162215106) is 2-oxobut-3-enyl hypofluorite.
What is the SMILES notation for 2-oxobut-3-enyl hypofluorite?
The canonical SMILES for 2-oxobut-3-enyl hypofluorite is C=CC(=O)COF.
What is the InChIKey of 2-oxobut-3-enyl hypofluorite?
The InChIKey is FOCKFIIECUQEOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FO2/c1-2-4(6)3-7-5/h2H,1,3H2.
What are the key properties of 2-oxobut-3-enyl hypofluorite?
2-oxobut-3-enyl hypofluorite has a molecular weight of 104.08 g/mol, XLogP of 0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxobut-3-enyl hypofluorite is sourced from PubChem (CID 162215106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).