About (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene
(3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene (PubChem CID 162216244) has the molecular formula C13H18ClN3O5
and a molecular weight of 331.76 g/mol. Its IUPAC name is (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene.
Molecular Properties
| Compound Name | (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene |
| PubChem CID | 162216244 |
| Molecular Formula | C13H18ClN3O5 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene |
| SMILES | NO[C@@H]1CCCN(C(=O)O)C1.O=[N+]([O-])c1ccc(CCl)cc1 |
| InChI | InChI=1S/C7H6ClNO2.C6H12N2O3/c8-5-6-1-3-7(4-2-6)9(10)11;7-11-5-2-1-3-8(4-5)6(9)10/h1-4H,5H2;5H,1-4,7H2,(H,9,10)/t;5-/m.1/s1 |
| InChIKey | ZTMRROPBLKKFMI-QDXATWJZSA-N |
| XLogP | 2.35 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene?
The IUPAC name of (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene (CID 162216244) is (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene.
What is the SMILES notation for (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene?
The canonical SMILES for (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene is NO[C@@H]1CCCN(C(=O)O)C1.O=[N+]([O-])c1ccc(CCl)cc1.
What is the InChIKey of (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene?
The InChIKey is ZTMRROPBLKKFMI-QDXATWJZSA-N. The full InChI is InChI=1S/C7H6ClNO2.C6H12N2O3/c8-5-6-1-3-7(4-2-6)9(10)11;7-11-5-2-1-3-8(4-5)6(9)10/h1-4H,5H2;5H,1-4,7H2,(H,9,10)/t;5-/m.1/s1.
What are the key properties of (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene?
(3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene has a molecular weight of 331.76 g/mol, XLogP of 2.35, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-aminooxypiperidine-1-carboxylic acid;1-(chloromethyl)-4-nitrobenzene is sourced from PubChem (CID 162216244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).