C60H74BN4O16 — CID 162216526
CID 162216526 (PubChem CID 162216526) has the molecular formula C60H74BN4O16 and a molecular weight of 1118.08 g/mol.
| Compound Name | CID 162216526 |
|---|---|
| PubChem CID | 162216526 |
| Molecular Formula | C60H74BN4O16 |
| Molecular Weight | 1118.08 g/mol |
| Exact Mass | 1117.52 |
| IUPAC Name | — |
| SMILES | COCOc1cc(OCCCN([B]C=O)c2ccccn2)cc2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(O)C1OC(C)(C)OC1C/C=C/2.C[C@@H]1/C=C\C(=O)C(O)C(O)C/C=C/c2cc(OCCCNc3ccccn3)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C33H42BN2O9.C27H32N2O7/c1-22-13-14-26(38)31-27(44-33(3,4)45-31)11-8-10-24-18-25(19-28(42-21-40-5)30(24)32(39)43-23(22)2)41-17-9-16-36(34-20-37)29-12-6-7-15-35-29;1-17-10-11-22(31)26(33)21(30)8-5-7-19-15-20(16-23(32)25(19)27(34)36-18(17)2)35-14-6-13-29-24-9-3-4-12-28-24/h6-8,10,12-15,18-20,22-23,26-27,31,38H,9,11,16-17,21H2,1-5H3;3-5,7,9-12,15-18,21,26,30,32-33H,6,8,13-14H2,1-2H3,(H,28,29)/b10-8+,14-13-;7-5+,11-10-/t22-,23+,26?,27?,31?;17-,18+,21?,26?/m11/s1 |
| InChIKey | OQFVLJYNNBBJPS-VSJBWLEBSA-N |
| XLogP | 7.30 |
| TPSA | 264.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.08 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|