carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane

C12H20CoO2 — CID 162217315

IUPACcarbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane
SMILESCC1C(C)C(C)C(C)C1C.[C-]#[O+].[C-]#[O+].[Co]
InChIInChI=1S/C10H20.2CO.Co/c1-6-7(2)9(4)10(5)8(6)3;2*1-2;/h6-10H,1-5H3;;;
InChIKeyABHBWFRVHSOSSG-UHFFFAOYSA-N
MW255.22 g/mol
LogP3.10
Rot. Bonds

About carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane

carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane (PubChem CID 162217315) has the molecular formula C12H20CoO2 and a molecular weight of 255.22 g/mol. Its IUPAC name is carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane.

Molecular Properties

Compound Namecarbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane
PubChem CID162217315
Molecular FormulaC12H20CoO2
Molecular Weight255.22 g/mol
Exact Mass255.08
IUPAC Namecarbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane
SMILESCC1C(C)C(C)C(C)C1C.[C-]#[O+].[C-]#[O+].[Co]
InChIInChI=1S/C10H20.2CO.Co/c1-6-7(2)9(4)10(5)8(6)3;2*1-2;/h6-10H,1-5H3;;;
InChIKeyABHBWFRVHSOSSG-UHFFFAOYSA-N
XLogP3.10
TPSA39.80 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.22
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane?
The IUPAC name of carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane (CID 162217315) is carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane.
What is the SMILES notation for carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane?
The canonical SMILES for carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane is CC1C(C)C(C)C(C)C1C.[C-]#[O+].[C-]#[O+].[Co].
What is the InChIKey of carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane?
The InChIKey is ABHBWFRVHSOSSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.2CO.Co/c1-6-7(2)9(4)10(5)8(6)3;2*1-2;/h6-10H,1-5H3;;;.
What are the key properties of carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane?
carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane has a molecular weight of 255.22 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;cobalt;1,2,3,4,5-pentamethylcyclopentane is sourced from PubChem (CID 162217315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).