About 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane
1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane (PubChem CID 162217428) has the molecular formula C9H13Cl2F2NO
and a molecular weight of 260.11 g/mol. Its IUPAC name is 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane.
Molecular Properties
| Compound Name | 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane |
| PubChem CID | 162217428 |
| Molecular Formula | C9H13Cl2F2NO |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane |
| SMILES | C.C=C(F)Cl.O=C1CCCN1C=C(F)Cl |
| InChI | InChI=1S/C6H7ClFNO.C2H2ClF.CH4/c7-5(8)4-9-3-1-2-6(9)10;1-2(3)4;/h4H,1-3H2;1H2;1H4 |
| InChIKey | ZTQUXAZVYOAMCJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane?
The IUPAC name of 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane (CID 162217428) is 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane.
What is the SMILES notation for 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane?
The canonical SMILES for 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane is C.C=C(F)Cl.O=C1CCCN1C=C(F)Cl.
What is the InChIKey of 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane?
The InChIKey is ZTQUXAZVYOAMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClFNO.C2H2ClF.CH4/c7-5(8)4-9-3-1-2-6(9)10;1-2(3)4;/h4H,1-3H2;1H2;1H4.
What are the key properties of 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane?
1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane has a molecular weight of 260.11 g/mol, XLogP of 3.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-fluoroethene;1-(2-chloro-2-fluoroethenyl)pyrrolidin-2-one;methane is sourced from PubChem (CID 162217428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).