C30H28N2O3 — CID 162218802
1,3-dimethyl-10H-acridin-9-one;2-(3,5-dimethylanilino)benzoic acid (PubChem CID 162218802) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 1,3-dimethyl-10H-acridin-9-one;2-(3,5-dimethylanilino)benzoic acid.
| Compound Name | 1,3-dimethyl-10H-acridin-9-one;2-(3,5-dimethylanilino)benzoic acid |
|---|---|
| PubChem CID | 162218802 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1,3-dimethyl-10H-acridin-9-one;2-(3,5-dimethylanilino)benzoic acid |
| SMILES | Cc1cc(C)c2c(=O)c3ccccc3[nH]c2c1.Cc1cc(C)cc(Nc2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C15H15NO2.C15H13NO/c1-10-7-11(2)9-12(8-10)16-14-6-4-3-5-13(14)15(17)18;1-9-7-10(2)14-13(8-9)16-12-6-4-3-5-11(12)15(14)17/h3-9,16H,1-2H3,(H,17,18);3-8H,1-2H3,(H,16,17) |
| InChIKey | ZTVMOHPSDAZAFP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|