About ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten
ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten (PubChem CID 162218828) has the molecular formula C15H29OSW-
and a molecular weight of 441.30 g/mol. Its IUPAC name is ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten.
Molecular Properties
| Compound Name | ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten |
| PubChem CID | 162218828 |
| Molecular Formula | C15H29OSW- |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten |
| SMILES | CCC1SC2(CCCO2)C(C)C(C)C1C.[CH2-]C.[W] |
| InChI | InChI=1S/C13H24OS.C2H5.W/c1-5-12-10(3)9(2)11(4)13(15-12)7-6-8-14-13;1-2;/h9-12H,5-8H2,1-4H3;1H2,2H3;/q;-1; |
| InChIKey | XUPFCPDMLDPRGT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten?
The IUPAC name of ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten (CID 162218828) is ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten.
What is the SMILES notation for ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten?
The canonical SMILES for ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten is CCC1SC2(CCCO2)C(C)C(C)C1C.[CH2-]C.[W].
What is the InChIKey of ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten?
The InChIKey is XUPFCPDMLDPRGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24OS.C2H5.W/c1-5-12-10(3)9(2)11(4)13(15-12)7-6-8-14-13;1-2;/h9-12H,5-8H2,1-4H3;1H2,2H3;/q;-1;.
What are the key properties of ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten?
ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten has a molecular weight of 441.30 g/mol, XLogP of 4.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane;tungsten is sourced from PubChem (CID 162218828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).